VISHWA BHARATI PUBLIC SCHOOL, NOIDA

CLASS: XII (2023-24)

SUBJECT: CHEMISTRY

Assignment type: Objective questions

Unit:6 - Haloalkanes and Haloarenes Prepared by-Manisha Sareen

A. MCQ Type questions with one correct answer

1. The less reactivity of chlorine atom in CH2 =CH-Cl is due to

a. inductive effect
b. resonance stabilization
c. electromeric effect
d. electronegativity
2. The replacement of chlorine of chlorobenzene to give phenol requires drastic
conditions but chlorine of 2,4-dinitrochlorobenzene is readily replaced since
a. NO2 makes the ring electron rich at o and p positions
b. NO2 withdraws electrons from the meta position
c. NO2 donates electrons at meta position
d. NO2 withdraws electrons from ortho and para positions
3. When chloroform is exposed to air and sunlight it produces
a. phosgene
b. acetylene
c. mustard gas
d. carbon tetrachloride
4. Bottles containing C6H5Br and C6H5CH2Br lost their original labels. They were
labeled A and B for testing. A and B were separately taken in test tubes and boiled
with NaOH solution. The end solution in each test tube was made acidic with dilute
HNO3 and then some AgNO3 was added. Substance B gave a light-yellow ppt. Which
one of the following statements is true for this experiment?
a. addition of HNO3 was unnecessary
b. A was C6H5 CH2Br
c. A was C6H5Br
d. B was C6H5Br
5. Toluene reacts with chlorine in presence of light to give
a. benzyl chloride
b. benzoyl chloride
c. p- Chlorotoluene
d. o- Chlorotoluene

B. Comprehension Type

Alkyl halides are best prepared from alcohols, which are easily accessible. The
hydroxyl group of an alcohol is replaced by halogen on reaction with concentrated
halogen acids, phosphorus halides or thionyl chloride. Thionyl chloride is preferred
because the other two products are escapable gases. Hence the reaction gives pure
alkyl halides. Phosphorus tribromide and triiodide are usually generated in situ

Vbpsnoida/chem/xii/2023-24
 (produced in the reaction mixture) by the reaction of red phosphorus with
bromine and iodine respectively.

Answer Q 6 to 10

6. Why alkyl halides are considered to be very reactive compounds towards

nucleophile?
a. they have an electrophilic carbon & a bad leaving group
b. they have a nucleophilic carbon & a good leaving group
c. they have an electrophilic carbon
d. they have an electrophilic carbon & a good leaving group.

7. Which of the following reactant gives the best method of preparation of alkyl halides
when reacts with alcohol?
a. Zn/HCl
b. PCl5
c. SOCl2/ Pyridine
d. PCl3

8. Which alkyl halide has the highest reactivity for a particular alkyl group?
a. R-F
b. R-Cl
c. R-Br
d. R-I

9. What will be the products when reactants are alcohol & thionyl chloride in the
presence of pyridine?
a. R-Cl + S + HCl
b. R-Cl + SO2 + HCl
c. R-Cl + SO2 + H2O
d. R-Cl + S + H2O

10. Match the reactions given in Column I with the appropriate reagent given in column II
Column I Column II

A CH3CH2OH → CH3CH2Br P NaI + H2SO4

B CH3CH2OH → CH3CH2I Q PBr5

C CH3CH2OH → CH3CH2Cl R Cl2

S KI + H3PO4

T NaBr + H2SO4

U HCl

C. Assertion-Reason Type
There are four statements for each question, out of these, only one is correct. You
have to identify correct statement.

Vbpsnoida/chem/xii/2023-24
 a. Both assertion and reason are correct statements and reason is the correct
explanation of the assertion
b. Both assertion and reason are correct statements, but reason is not the correct
explanation of the assertion.
c. Assertion is correct, but reason is incorrect statement.
d. Assertion is incorrect, but reason is correct statement.

11. Assertion: CH3Br + NaCN → CH3CN + NaBr

Reason: CN- is an ambident nucleophile
12. Assertion: p- dichlorobenzene has higher solubility than o- and m- isomers.
Reason: Being more symmetrical, p- isomer fits closely in the lattice and thus has
stronger forces of attraction than o- and m- isomers.
13. Assertion: Benzyl chloride undergoes nucleophilic substitution much more readily
than CH3Cl.
Reason: The intermediate carbocation formed in case of substitution of benzyl
chloride is less stable than in case of CH3Cl
14. Assertion: n- Butyl chloride has higher boiling point than n- butyl bromide.
Reason: C – Cl bond is more polar than C – Br bond.
15. Assertion: Propene reacts with chlorine in presence of sunlight to form allyl chloride.
Reason: Allylic chlorination proceeds through free radical substitution.

D. One Word Type

16. Write the IUPAC name of p-Cl C6H4 CH2 CH (CH3)2

17. Name a hydrocarbon C4H10which is different from the compound formed when ethyl
bromide is reacted with sodium.
18. Which of the two would you expect to have lower dipole moment: chlorobenzene or
cyclohexyl chloride?
19. C-Cl bond in chlorobenzene is shorter than in cyclohexyl chloride. (True/False)
20. 1- iodopropane can be prepared from 1- chloropropane by refluxing it with………….

E. MCQ Type questions with one or more correct answers

21. Ethylene dichloride and ethylidene chloride are isomers. Identify the correct
statements
a. Both the compounds are optically active
b. Both the compounds form same product on reduction
c. Both the compounds form same product on treatment with alcoholic KOH
d. Both the compounds form same product on treatment with aq. NaOH
22. An organic compound 'X' reacts with CH3MgBr followed by hydrolysis to form
secondary alcohol. What is true about 'X'
a. 'X' is formaldehyde
b. 'X' is an aldehyde other than formaldehyde
c. 'X' is a ketone
d. 'X' undergoes nucleophilic substitution reaction with Grignard reagent
e. 'X' undergoes nucleophilic addition reaction with Grignard reagent
23. Compound 'A' with molecular formula C4H9Br is treated with aq. KOH solution. The
rate of the reaction depends upon the concentration of the compound 'A' only. When
another optically active isomer 'B' of this compound was treated with aq. KOH

Vbpsnoida/chem/xii/2023-24
 solution, the rate of reaction was found to be dependent on concentration of
compound and KOH both. Choose the correct statements
a. A is tert-butyl bromide and 'B' is sec-butyl bromide
b. 'A' is n-butyl bromide and 'B' is isobutyl bromide
c. 'B' will be converted to the product with inverted configuration
d. 'A' follows SN1 mechanism
e. Both A and B form carbocation as an intermediate
24. The different reagents required for the preparation of phenol from benzene are
a. alc. KOH
b. aq NaOH
c. Na metal
d. conc H2SO4
e. conc H2SO4 + conc HNO3
25. IUPAC name and classification of the compound CH3CH=C(Cl)CH2CH2CH(CH3)2 is
a. 3-Chloro-6-methylhept-2-ene, tert-alkyl halide
b. 5-chloro-2-methylhept-5-ene, allylic halide
c. 3-Chloro-6-methylhept-2-ene, vinylic halide
d. 5-chloro-2-methylhept-5-ene, sec-alkyl halide

ANSWER KEY
1.(b) 2. (d) 3. (a) 4. (c) 5. (a)
6. d
7. c
8. d
9. b
10. A-T, B-S, C-U
11. (a) 12. (d) 13. (c) 14. (d) 15. (a)
16. 1-Chloro-4-(2-methylpropyl) benzene
17. 2-Methylpropane
18. Chlorobenzene
19. True
20. NaI in dry acetone
21. b, c
22. b, e
23. a, c, d
24. b, d
25. c

Vbpsnoida/chem/xii/2023-24