Professional Documents
Culture Documents
General: Preparedby Mr. Gadisa K
General: Preparedby Mr. Gadisa K
2
GENERAL
SCIENCE 0
WORK
BOOK 2
3
Preparedby
Mr. Gadisa K
Introduction:
The term work book refers to a book designed to guide the work of a student by inclusion of
questions,reviewexercises,etc.Itisanexercisebookortextbookusedforstudy,especiallyatext
bookwithspacesforanswers.Itisalsousuallyfilledwithpracticeproblemsandwithemptyspace
sothattheanswerscanbewrittendirectlyinthebook.In-otherwords,studentworkbookisatype of an
education material that typically include components to support classroom learning. They help
ensuring students‟ knowledge and ability in line with the acquisitions stated in teaching
programs.
Therefore;thisworkbookispreparedforgrade8studentstodomuchmorevarietyquestionsthan
questions present in the text and how to tackle some challenge problems. Such conditions made
students to have the chance to expose to many different item types questions and they are able to
measuretheirabilityand skills.Thequestionsarepreparedbasedonthenewcurriculumwithfive item
types, like true-false; matching, fill in the blank spaces, multiple choices, short answers and
essaytypes.
To sum up, the main purpose of this work book is to ensure that to what extent students have
acquired knowledge, ability and skills in general science lesson.
To the students:
To be successful in General Science lesson and other subjects, students should follow the
followings bit of guide lines.
1. First,havearegularstudyprogramforeachsubject.Thiswillhelpyoutosavetime,energyand to
become an effective student.
2. List and defined those key terms in each unit. This will help you understanding theunit.
3. Do those activities, experiments and projects in each page of the unit. This increases your
appetite for learning and scientificcuriosity.
4. List down those exceptional concepts alone. This again assist you to avoid misconceptions;
misunderstanding.
5. Do all the various types of exercise and problems in the unit to check your understanding. This
will assist you to check your ability and to recall what you have learned sofar.
6. Develop your ability and skills in problem solving strategy. This enables you to develop your
mathematical operations and to create new scientificidea.
7. Haveahabittoreadthetopiclessonbeforeyouenterinclass.Thisinitiatesyouto understand
the concept easily when a teacher isteaching.
1
Review exercises and problems on
UNIT ONE- SCIENTIFIC MEASUREMENT ANDINVESTIGATION.
I. Matchingquestions:
Part-one: Match the items in column A with that of column B.
Column“A” Column “B”
1. Handspan A. known as fathom
2. Digit B. measuring from the heel of one foot to the samefoot.
3. Cubit C.measuresfromthebackoftheheeltothetipofthebigtoe.
4. Foot D. width of an adult human malefingertip.
5. Pace E.measuresfromthetipofone‟selbowtothetipofmiddlefinger.
6. Armspan F. measures from the tip of finger to the tip ofthumb.
Part two: Match the items under column A with that of column B.
Column“A” Column “B”
1. WeQet A. measures the mass of pepper andcoffee
2. Quntal B. a plastic cup measures the volume ofliquids
3. Feresula C. measures cereals, pulses, liquids andsolids.
4. Jog D. a glass measures pulses andliquids
5. Birchiko E. measures the mass of powder of gold.
6. Kubaya F. a mug measures pulses, cereals andliquids.
7. Tassa G. measures the mass ofgrains.
Part three: Match the quantities under column A to their units under column B.
Column“A” Column“B”
1. Length, L A. Second,s
2. Mass,M B. Kelvin, k
3. Time, t C. Ampere,A
4. Temperature,T D. Kilogram, Kg
5. Electriccurrent,I E. kilogram per cubic meter,Kg/m3
6. Density,d F. meter,m
7. Volume, v G. cubic meter,m3
II. Fill in the blank spaces with an appropriateanswer.
1. A method of measuring that practiced locally iscalled
2. Measure of a distance from the heel to one foot to the heel of the sameis
3. The amount of matter present in a substance isreferredto .
4. Thedistancefromthemiddlefingertipofthelefthandtothatoftherighthandcanbemeasured by .
5. Measuring the space occupied by an object isknown as .
6. Quantities that can be measuredarecalled _.
7. The unit ofareais , while that of densityis
8. The prefix for a numbero.ooo1 is .
2
9. One thousand centimeter isequal to meter.
10. The device used to measure the temperature of anobject is .
11. The SI unit oftemperatureis , while that of timeis .
12. The mass of a sample can bemeasuredby .
13. A short hand form of writing very large and very small numbers isknown as .
14. Physical quantities are classified intotwo,namely and .
15. A quantity which cannot be expressed in terms of any other quantity isreferred to .
16. A physical quantity has two components.Theseare and .
17. The process of obtaining the magnitude of a quantity relative to an agreed standardis
.
III. Multiple choicequestions.
Choose the correct answers from the given alternatives.
1. Which of the following physical quantity is a derivedquantity?
A. Volume B.Time C.Temperature D. Mass
2. Which of the following is a fundamental physicalquantity?
A. Velocity B. Density C. Volume D. electriccurrent.
3. The SI-unit of volumeis
A. Kg/m B.Kg/m2 C.Kg/m3 D. Kg/m2
4. Which one of the following set of physical quantities represents fundamentalquantities?
A. Time,Speed,Mass C. Temperature, Time,Length
B. Force,Velocity, density D. Area, Volume,Length.
5. From the followings an indigenous units of measurement for lengthis
A. Kilometer B.Span C.Shadow D. Weqet
6. The prefix that represents as 1/1000is
A. Kilo B.Mega C.Milli- D. Centi-
7. An instrument used to measure fractions of very small lengthis
A. Meterruler B.Measuringcylinder C.Verniercaliper D. Beambalance
8. The last steps of scientific methodis
A. Observation B.Hypothesis C. Theory D. Scientificlaw
9. A general statement that summarizes facts that come from many experiments iscalled------
A. Theory B.Scientificlaw C. Hypothesis D. Observation
10. In scientific work, temperature is oftenmeasuredon scale
A. Kelvin B.Celsius C. fahrenheit D. all of these
4
II. Fill in the blank spaces with appropriateanswers.
1. Most of the mass of an atom is mainly concentratedin
2. The total positive charged in the nucleus of an atomis
3. The fundamental particle that is not present in hydrogen atomis
4. The two regions of anatom are and
5. The only element of an atom that has no neutron particleis
6. The particle that has nearly the same mass to a proton of hydrogen atomis
7. A path of an electron in atom is referredto
8. The building blocks of all substancesis
9. The mass of electronis _ times less heavier than protons andneutrons.
10. The actual charge ofprotonis and that of neutronsis
11. An atom is represented by thenotationof .
12. Theideaof„atoms‟firstproposedbytheGreekphilosophernamed
5
12. Most of the volume of an atom is occupiedby;
A. Protons C.Neutrons
B. Electrons D. protons andneutrons.
13. From the followings an example of a poly-atomic moleculeis
A. Ozone B. Oxygen C. Carbon D.Chlorine.
14. All of the followings are diatomic moleculesexcept.
A. Iodine B.Hydrogen C.Nitrogen D. Carbon
15. The total sum of number of protons and number of neutrons in the nucleus of an atomis
A. Atomicnumber B. Atomicmass C.Mass number D. atomicshell
39
16. The number of neutrons in 19Kare
A.20 B. 19 C. 58 D. 39
17. Which of the following statement is true about the nucleus of anatom?
A. It contains onlyneutron particles C. It contains protons andelectrons
B. It ispositivelycharged D. It occupies largevolume.
18. The continuous theory of matter proposedby
A. Democritus B.Thales C. Aristotle D. John Dalton
19. Structurally, what is anatom?
A. It is the smallestspherical body C. It is massive at the center of thenucleus
B. It consists of protons andneutronsparticles D. all of theabove.
20. The continuous theory of matter described the factthat
A. Substance divided up to a certainpoint
B. Substance divided withoutlimit
C. Substance cannot subdivided into smallerpieces
D. Substances combined together instead ofdividing.
21. The smallest possible number of atoms in a moleculeis
A. Four B.Three C. Two D. One
22. Which one of the following pairing is correctlymatched?
A. Oxygen---poly-atomicmolecule C. phosphorus---mono-atomic atom
B. Ozone---diatomicmolecule D.Helium ---- mono-atomic molecule.
23. Which property made that atom and molecule to besimilar?
A. Both have two atomsper molecule C. Both have the samestructure
B. Both areneutralparticles D. both arestable
24. Which of the following pair of sub-atomic particles are always equal to neutralatom?
A. Protonsandneutrons C. mass number and atomic number
B. Neutronandelectron D. protons and electrons
25. Why is an atom electrically neutral? This isbecause
A. The number of neutrons equal to the number ofprotons
B. The number of protons equals to number ofelectrons.
C. The number of neutrons equal to the number ofelectrons.
D. All of these
26. Which of the following statement is false about the atomicstructure?
A. The electrons occupy a very large volume space tonucleus.
B. Almost all the mass of the atom is concentrated in thenucleus.
C. The protons and the neutrons in the nucleus are very tightlypacked.
D. All neutral atoms of a given element have the same number ofelectron
6
27. The following table shows the comparison between continuous and non-continuous theory ofmatter.
Continuous theory Non-continuous theory
1. Matter is divisible Matter is indivisible
2. The existence of atoms is not accepted The existence of atom is accepted.
3. Matter is indivisible Matter is divisible
In the above table, which row contains the wrong comparisons? A. 1 and 2
B. 2and 3 C.only1 D. only3.
28. Which one is not true about the diagrammatic representation of theatom?
A. Letter C represents the electronshell. A. B
B. Letter B indicates the nucleus of anatom cC
C. Letter A stands for an electron revolving around thenucleus.
D. Letter C indicates the location of protonsparticles. C
7
15. Complete the following tableaccordingly.
Atomic Atomic Number of Number of Number of Mass number
symbol number(Z) protons neutrons electrons
1H
1
31P
15
23 Na
11
32S
16
238 U
92
56 Fe
26
9
10. What is the molecular formula of a member of the homologous series of alkene with 11– Carbonatoms?
A.C11H11 B.C11H20 C.C11H12 D. C11H18
11. Which of the following is the main use ofalkane?
A. forfuel C. for production ofalkene
B. forsolvent D. for makingexplosives
12. The 10 – carbon alkyne has the molecularformula
A.C10H18 B.C2H6 C.C3H8 D. C4H10
13. The main combustible gas obtained from a biogas plantis
A. CH4 B.C2H6C. C3H8 D. C4H10
14. An alkene that can be found in the liquid state at room
temperatureis:A.C8H16 B.C5H10 C.C18H36 D. C4H8
15. The hydrocarbon structure of CH3 = CH - CH2 - CH2 – CH3 refersto
A. Alkene B.Alkyne C.Alkane D. Alkylgroup
16. The hydrocarbon compound named as n- pentyne has the
formula:A.C5H12 B.C5H10 C.C5H8 D.C5H11
17. The crude oil product used at home for fuelis
A. Natural gas B.Butagas C. Benzene D. Ethanol
18. Which of the following hydrocarbon compounds is correctly arranged in order of increasingmelting
point anddensity?
A. CH4>C2H6>C3H8 C. C3H8> C2H6>CH4
C H >C
B. 2 6 3 8H >CH 4 D. C 2 6 CH4>C3H8
H >
19. Organic compounds that differ by a constant -CH2 group arecalled
A. Allotrope C.Hydrocarbon
B. Isotopes D. Homologousseries.
20.which statement is true aboutalkanes?
A. They aresaturatedhydrocarbons C. They are chemically inert to manyreagents.
B. They have generalformulaCnH2n+2 D. None ofthese
21. Alkanes differ from alkenes inthat;
A. They are saturatedhydrocarbons
B. They are more reactive thanalkenes.
C. They have less hydrogen atoms thanalkenes.
D. They do not show the homologousseries.
22. Ethanol is notused
A. Asalcoholicbeverage C. As afuel
B. Ascleaningwounds D. As preservation ofinsects.
23.Ethene and propene are gaseous of alkenes. They areused
A. For the productionofplastics C. for cutting and weldingsteel
B. For cookingfood D. for lighting.
24. Which of the following is not the use of aceticacid?
A. Food flavoringagent C. Preservingvegetables.
B. Preservativebiologicalspecimens D.Disinfectant
25. The vinegar is a solutionof;
A. 5%aceticacid C. 10% aceticacid
B. 15%aceticacid D. 50% aceticacid
26. How many hydrogen atoms are there in the straight chain of alkene that have five carbonatoms?
A.10 B.11 C. 12 D. 8
10
V: Essay type – item questions.
1. What was the belief of vital force theory? Who disproveit?
2. What is the name and formula of the first organic compoundsynthesized?
3. List the major elements associated with carbon producing different types of organiccompounds?
4. What are the reacting inorganic substances that producedurea?
5. What is:
i) The old definition of organicchemistry
ii) The modern definition of organicchemistry
6. Identify the differences between organic compounds and inorganiccompounds?
7. What are the primary sources of organiccompounds?
8. Give some reacting inorganic substances to prepare organicones?
9. What does organic chemistry studyabout?
10. What are hydrocarboncompounds?
11. Sketch the structural division of hydrocarbon compounds on the basis ofstructure?
12. Reason out why does carbon form many organiccompounds?
13. Why formalin is used for preservation of biologicalspecimens?
14. What are the simplest classes of hydrocarboncompounds?
15. List down the main characteristicsof
i) Alkanes ii)Alkenes iii) Alkynes
16. What is the main source of obtainingalkanes?
17. What are homologous series of compounds? What properties do theyhave?
18. Define what a function group ismeant?
19. What is the functional group presentin?
i) Alkanes ii)Alkenes iii)Alkynes
20. What is indicating a prefix? a suffix? In hydrocarboncompounds
21. What is the first memberof?
i) Alkane ii)Alkene iii)Alkyne
22. Why are the boiling points and melting points of alkane compounds increased with increasing carbonnumber?
23. Write the range of carbon atoms where alkanes can existas?
i) Solid ii)liquid iii) gaseousstate
24. Classify the following alkane members as solid, liquid or gaseousstate:
C4H10, C7H16, C16H34, C20H42, C3H8, C10H22,C5H12
25. What are the products obtained when propane compound burn withoxygen?
26. Write all usesof
i) Alkane ii)Alkene iii) Alkyne compounds
27. What are alkyl groups? How they different fromalkanes?
28. What is the first, the third, the fifth and the seventh memberof?
i) alkanes iii)alkynes
ii) Alkenes iv) alkyl groups
29. State the properties of alkenes on the basisof
i) meltingpoint iii)density
ii) Solubility iv) states ofmatter
30. What would be the molecular formula for a straight chain hydrocarbons having 17 – carbon atomsand
i) All C – C singlebonds
ii) One C – C triplebonds
iii) Two C – C doublebonds
List down the most important application of acetylene?
11
3.2. Inorganiccompounds
Review exercises and problems on-Oxides, Acids, Bases and Salts
A. Oxides:
I: True – False item questions
1. Potassium reacts with excess oxygen, formingperoxide.
2. On adding litmus paper to a solution of CO, a red color willproduce.
3. The compounds PbO2 and CaO2 are examples of basicoxide.
4. An element with atomic number 14 can form basicoxide.
5. The color of the product when sulphur burned in air is a blueflame.
6. Metals like gold, platinum and palladium react with oxygen to fromoxides.
7. Metallic oxides react with acids to from salt andwater.
8. The compound NO2 is a basicoxide.
II: Matching item questions
Column “A” Column “B”
1. Neutral oxides A. shows property of acidic instead of basic
2. Acidicoxide B. Pt, Au, and Pd elements
3. Noblegases C. do not shows acidic and basic properties
4. Basicoxides D. do not react under ordinary conditions.
5.Un reactivemetals E. change litmus paper to blue.
F. change litmus paper to red
III: Fill in the blank spaces
1. Acid anhydride +Basic oxide ? + ?
H
2. The P value for acid anhydrideis
3. The type of oxide that has no action on litmus paperis
4. From the oxides of carbon, the neutral oxideis
5. The anhydride forms of Mg (OH2)is
6. Among the metals that do not form oxidesaregold, and
7. Oxides are binary compoundsformed from and
8. The type of oxide that changes litmus paper to red coloris
IV: Multiple choice questions
1. A type of oxide that can form a salt and wateris
A. Acidicoxide B.Basicoxide C.Neutraloxide D. None of theabove
2. When metals react with oxygen they mayform:
A.Basicoxides B.Peroxides C.Neutral oxides D. All of these
3. What color change would you see on adding litmus paper to a solution ofSO2?
A.Blue B. Red C. Colorless D.Yellow
4. Which one of the following naming of oxides iscorrect?
A. Fe2O3 – isironoxide C. Na2O2 – is sodiumperoxide
B. Al2O3 – isaluminumtrioxide D. CaO2 – is calciumoxide
5. Which one of the following statements is correctlystated?
A. NO2 – is aneutral oxide C. ZnO2 – is acidicoxide
B. K2O – is abasic oxide D. NO – is neutraloxide
12
6. An eighth grade student tested solutions of some unknown oxides and the results are asshow
below.
PH of solution 13 2 7 9 1
Unknown oxide A B C D E
Which metal oxide is an alkali?
A.B B. A C. D D. E
7. From Q6 above, which are the oxides of a non –metals?
A. Aand D B. B and E C. C and D D. B andC
8. Among the following oxides, which one will produce an acidic solution when dissolves inwater?
A.Na2O B. N2O C.CO2 D. NO
9. From the followings, identify the neutraloxide
A. CaO B. K2O C. H2O D. SO2
10. Which of the following oxides has neither basic nor acidicbehavior?
A. CO B.P2O3 C. K2O D. Al2O3
11. From the following compounds which one can produce basic solution inwater?
A.ZnO B.Al2O3 C.SO2 D. BaO
12. Most reactive metals react with oxygen toform:
A. neutraloxides B.Basicoxides C.Peroxides D. Hydroxides
13. Which one of the following elements forms insoluble basicoxides?
A. Calcium B. Silicon C. Sulphur D. None ofthese
14. A type of oxide that cannot form a saltis
A. Basic oxide B.Acidoxide C.Neutraloxide D. Salt
15. Oxides can be prepared by one of the following methods.Identify
A. Neutralization B. PrecipitationC.Decomposition D. All ofthese
16. Which one of the following elements can form neutral oxide as well as acidic oxides withoxygen?
A. SulphurB.Hydrogen C.Nitrogen D. Phosphorus
17. With which of the following elements that oxygen may react to fromoxide?
A. Pt B.Ne C. Au D. Fe
18. Metals are able to react with oxygen to from oxidesexcept
A. Magnesium B. Copper C.Iron . Gold
19. Consider the followingoxides.
I.SO2 II.N2O3 III.Al2O3 IV, N2O V.
H2OThe acidic oxidesare;
A. I, II and IV B. II, III and IV C. Iand II D. IV and V
H
20. The oxide dissolves in water to produce a P value equal to 7is
A. Na2O2 B.Al2O3 C.NO2 D. N2O
13
V: Essay type item questions
1. From the oxides of nitrogen,identify
i) The neutral oxides? ii) The acidicoxides?
2. Why litmus paper does not bring a color change in distilledwater?
3. Define the followings and give examples foreach
i) Oxides ii)metallicoxides iii) nonmetallicoxides
4. Write two basic chemical properties for each of thefollowing
i) Neutraloxides ii)Acidicoxides iii) MetallicOxides
5. Classify the following oxides as acid anhydrides, basic anhydrides, or neutral oxides, where
possible.(H2O, H2O2, Na2O, Na2O2, BaO, BaO2, SnO, SnO2, PbO2, PbO, Cr2O3, MnO2, CO, CO2, NO,
N2O, NO2, SO2, B2O3, Fe2O3,FeO)
6. Complete and balance the followingreactions
i) Di-nitrogen pent-oxide +water
iii) CaCO3+ CO2+H2O
iv) Na2O +SO3
v) Al2O3+HCl
vi) S + O2 + H2O ?
vii) Mg+O2? + ?
H2O
7. Give basic reason for each of thefollowing
i) Noble gases do not form normaloxides.
ii) Chromium oxide (CrO3) shows the property of acid rather thanbasic
8. Mention the elementsthat
i) Cannotformoxides ii) can form only oneoxide
ii) Can form onlytwo oxides iv) can form more than twooxides
14
II: Matching - item questions
Column “A” Column “B”
1. Ammonia water,NH4OH A. Anti – acid compound
2. Hydroxide ionOH- B. Alkali
3. Solublebases C. combination of lime and water
4. Milk ofmagnesia D. contains H+and OH-ions
5. Calciumhydroxide E. characterize the properties of bases
6. Watermolecule F. basic anhydride of Al (OH)3
7. Aluminumoxide G. molecular base
8. Sodiumhydroxide H. the extent of dissociation
I. PH value less than seven
J. soap making
III: Fill in the blank spaces
1. The base substance used to treat the acid in human stomachis
2. The color of phenolphthalein in basic solutionis
3. A substance that indicates the acidity or alkalify of a solution is knownas
4. Neutralization reaction is thereactionbetween & ions.
5. Alkali bases react with ammonium salts to formsalt and .
6. When solution of hydroxides and acids aremixed,the and ions combine toform
7. The positive ion ofbaseis or
8. Strong alkalis have a POHvaluerangingfrom to
9. Complete the reaction: Ca+ H2O Ca (OH)2+ ? .
10. NaOHis a base where as NH4OHis a base.
15
9. All bases releaseionsof .
A. Oxides B.Proton C.Hydroxide D. Hydronium
OH
10. As the base-city of a solution increases, its P value
A. increase B.decrease C. remainthesame D. becomesneutral
11. From the given table, which one is the strongestbase?
A. A andC C. B andD Unknown A B C D
base 11 9 13 8
B. A andB D. B and C
PH solution
12. From the followings, an example of a non –metal baseis
A. ammoniumion C. watersolution
B. ammoniasolution D. magnesiumhydroxide
13. From the followings, an insoluble base in aqueous solutionis
A. NH3 B.NaOH C. Rb(OH) D. Mg(OH)2
14. Which of the following reaction does not produce Ca (OH)2?
A. Ca + H2O B.CaCl2+NaOH C. CaO+ H2O D. CO2 +CaO
15. Which of the following reaction can be used to prepare abase?
A. acid anhydrideandwater C. active metals andwater
B. active metalsandacids D. metallic oxides and acidicoxides
16. The only non – metallic baseis:
A. Zn(OH)2 B. CaO C.NH4OH D. CaH2
17. Which of the following is true about the properties ofbases?
A. Bases have a POHvalue greaterthan 7 C. Bases feel soapy on theskin
B. Bases have abittertaste D. All of the above aretrue
18. Which one of the following is a strongbase?
A. Ba(OH)2 B.Mg(OH)2 C.NH4OH D. Fe(OH)3
19. Both acids and bases show the following propertiesexcept?
A. changes the coloroflitmus C. conduct electriccurrent
B. form ions inwatersolution D. have similar PHvalue.
20. When you preparing a solution in the laboratory, a base is splashed on your friend eyes. What you are going todo?
A. Giving milkofmagnesia C. Giving boricsalt
B. Giving ofaceticacid D. Giving ammoniasolution
21. Which one of the following properties does not belong to both bases and acidicsolution?
A. Changing the coloroflitmus C. Reacting with activemetals
B. Being dilutedorconcentrated D. Formation of ions
22. Which one of the following solutions is the strongestbase?
A. ammoniasolution C. Magnesium hydroxidesolutions
B. Sodiumhydroxidesolution D. Aluminum hydroxidesolutions
23. Which of the following is not the use of neutralization athome?
A. Toothpaste C. Conditioner
B. Bakingpowder D. Cure wasp stings.
24. When vinegar and baking soda are mixed together, which gas isproduced?
A.Oxygen B. Nitrogen C.Hydrogen D. Carbon-dioxide.
25. The following table shows the effect of indicators on acidicsolutions
Indicators Acids
1. Red litmus Turns to blue
1. Blue litmus Turns to red
2. Methyl orange Turns to yellow
3. Phenolphthalein Turns to pink.
In the table above, which indicator shows wrong response to the acidic solution?
A. 3and4 B. 4and 2 C. only4 D. only2
16
V: Essay type item questions
1. Define the following terms and give examples foreach
i) Base iii)Strongbase v) Concentrated basicsolution
ii) Weakbase iv)Alkali vi) dilute basicsolution
2. Give some common basecompounds
3. Jot down the common properties of basecompounds
4. Identify the metal hydroxide for each of the following basic
oxide?Na2O, FeO, Al2O3, CuO,MgO
5. Draw a PH – scale and indicate the place for strong acids, strong bases and neutralconditions.
6. What are the common properties for both acids andbases?
7. Name the base substanceused
- to make soap anddetergents
- to make soft soap
- as anti-acid in humanstomach
- as a medical and a laboratoryreagents
8. Give at least three examples for each of thefollowing
i) Soluble bases ii)
Slightly soluble iii)
Insolublebases
9. Write an equation for the ionization of the following bases inwater
i) NH3 iii) Ba(OH)2 ii) Al(OH)3 iv)Rb(OH)
10. What kind of substance can weuse?
10.1. if an acid is spilled onclothing
10.2. To reduce the acidity of asalt
10.3. If a base is spilled onclothing
10.4. If a person suddenly swallow anacid?
10.5. If a person is stung by ants orbees?
11. If too much HCl acid present in stomach, what kind of base can be used to neutralizeit?
C. Review exercises and problems onAcids
I: True – False item questions
1. Compounds containing hydrogen are considered to beacids.
2. PH is inversely proportional to the concentration of hydrogenions.
3. Acids are compounds which release hydrogen gas in aqueoussolution.
4. When carbonates react with acids, the gas released turns lime watermilky.
5. The strength of an acid is measured by the extent of its ionization insolution.
6. The main uses of HCl acid is for making explosivesubstances.
7. Using our tongue, we can prove that acids have a sourtaste.
8. Acids neutralize bases due to the formation ofsalt.
9. In universal indicator, yellow color indicates strongacid.
10. Pour water into a test tube, containing concentratedacid.
11. Asolutionwith PH=2 is more acidthanone with PH= 4
17
II: Matching item
Column“A” Column “B”
1. Nitrousacid A. an acid found invinegar
2. Abinaryacid B. neutralizationreaction
3. Carbonic acid C. strongacids
4. Mineral acid D. has a PH value7
5. Citricacid E. hydro sulfuric acid,H2S
6. aceticacid F. phosphoricacid
7. Combination of acidswithbases G. acid anhydride of N2O3
8. Distilwater H. „Ambowater‟
9. Dissociategreatly I. an acid found in lemonjuice
10. Phenolphthalein J. an acid found inants
K. colorless in acidic solution
L. changes litmus paper to blue color
III: Fill in the blank spaces.
1. An acid that is important in the human digestive systemis
2. The basic property of all acids isdueto ion formation.
3. The reaction between acids and bases is knownas
4. When acids react with active metals, the substance formedare
5. A solution of acidic oxide turns methylorangeto color.
6. An acid formed when milk become souris
7. Aquaregia is a mixture of nitricacid and acid.
8. All acids release ionsof
9. The nitrogen oxide obtained by dehydration of HNO3 acidis
10. The gas evolved when zinc reacts with dilute HCl acidis
11. A gas prepared in the laboratory by reacting HCl with CaHCO3is
12. Hydrogen ion reacts with watertoproduce ion.
18
8. Acids can be prepared by the followingexcept
A. Direct unionofelement C. Nonmetallic oxide withwater
B. Nonmetal with another non– metal D. Concentrated acid withsalt
9. When calcium carbonate reacts with HCl acids, which one does notformed?
A. CaCl2 B.CO2 C. CaO D. H2O
10. The main uses of nitric acid (HNO3) is in the manufactureof
A. Soaps B.Fertilization C.Carbatteries D. Picklingmetals
11. Nitrous acid (HNO2) is produced by reacting waterwith
A. N2O5 B.NO2 C.N2O3 D. N2O
12. Which of the following substance contains anacid?
A. Aspirin B.Vinegar C.Ambowater D. All of theabove
13. Weak acids differ from strong acidsby
A. Having PH greaterthanfour C. Releasing more H+ions in watersolution
B. Giving a sour test inwatersolution D. Changing methyl orange tored
14. The acid used in the manufacturing of detergents, fertilizers and explosivesis
A. HCl B.HNO3 C. H2SO4 D. H2CO3
15.Tella turns to sour when left open for sometimes. The sour test is due to the formationof:
A. ethanolalcohol B. aceticacid C.water D. yeast
16. Sulfurous acid is preparedby
A. dissolving SO2inwater C. dissolving SO3 inwater
B. dissolving Sinwater D. dissolving H2S inwater
17. Which of the following substances have a PH less than7?
I. H2O II. Vinegar III. Lemon IV.CO2 V. Causticsoda
A. IandV B. II, IIIandIV C. I, IIIandV D. II andIII
18. Which statement is correct about the properties ofacids?
A. Acids change the color of methyl orange toyellow
B. Acids release H+ ions insolution
C. Acids are compounds that containhydrogen
D. All are correctanswers
19. The strength of an acid can be identified byits
A. PHvalue B.Solubility C.Density D.Mass
20. As the acidity of a solution increase its PHvalue
A. increase C. remain the same (nochange)
B. decrease D. becomesneutral
21. Which one of the following solutions has the greatest PHvalue?
A. Purewater C. Concentrated HClacid
B. Vinegar D. ConcentratedKOH
22. Which is the safest technique for diluting concentratedacid?
A. Add water to the acid while stirringsteadily C. Add water to the acid and shake quickly
B. Add acid to the water while stirringsteadily D. Add water to the acid quickly
23. Identify the correct statement aboutacids
A. Organic acids areweakacids C. The PH value of acid is equalseven
B. Acids have abittertaste D. Acids react with metals to formbase
24. Which one of the following acids does not containoxygen?
A. Sulfuricacid B.Nitricacid C. Aceticacid D. Hydrochloricacid
25. Which of the following are common uses of HCl, HNO3 andH2SO4?
A. making of explosive C. for production of KNO3
B. for production of phosphate D. for production of drugs
26. A solution with a PH12 is;
9. What are the methods applied to identify whether a given solution is acidic, neutral or basic. Give
examples for youranswers.
10. Consider the PH scale as shownbelow
PH 1 2 3 4 5 6 7 8 9 10 11 12 13 14
A B C D
10.1 Which letter A, B, C or D represents the PH of thefollowing?
i) Sulfuric acid ii)Water
iii) Sodiumhydroxide
10.2 What name is given to the type of chemical reaction that takes place when a liquid of PH = 1is
added to liquid of PH =14
120
2
11. Five solutions (A to E) were tested with a universal indicators solution. The results are shownbelow.
A B C D E
A B C D E
Green Yellow Violet Green Colorless
Which solution is
i) Neutral? ii) Strong acid? iii) Weakacid?
14. A mixture of zinc and dilute sulfuric acid mixed together in a test tube as shown in the figure.Answer
the followingquestions
i) What substance is formed? Is it soluble in water? ii) Why was it
necessary to heat the reactionmixture?
iii) Write the equation for the reaction?
Heat
15. What color change would you see on adding litmus paper to a solutionof
i) CO ii)CaO iii) SO2
16. Complete the following tableaccordingly.
Color of the indicator in
Solution Red litmus Blue litmus Methyl orange Phenolphthalein
NaOH
HCl
NH4OH
121
2
E. Review exercises and problems on Salts
I: True – False itemquestions
1. Salts can possess the behavior of acids as well asbases.
2. Large quantities of salts are found in seawater.
3. CaCO3, Na2SO4 and NH4Cl are binarysalts.
4. The compound CaCO3 used to neutralize acidicsoil.
5. A base and acid anhydride combined together to give salt andwater.
6. BaSO4 is a salt of H2SO4 acid and a base of Ba(OH)2.
7. When calcium reacts with nitric acid a binary compound isformed.
8. A salt can have a bittertaste.
9. Some salts are soluble and some are insoluble inwater.
10. A salt can be obtained from the combination of othersalts.
II: Matching item questions
Column “A” Column “B”
1. Binarysalts A. salts of hydro sulphuric acid
2. Ternarysalts B. does not form a salt
3. Neutralizationreaction C. called rock salt
4. Sodium hydrogencarbonate D. compounds derived from acids and bases
5. Sodiumchloride E. sulphate
6. Sulphide F. salts containing only two elements
7. Salts G. combination of base and acid
8. Neutral oxides H. a bitter salt
I. used as fire extinguisher
J. salts containing more than two elements
III: Fill in the blank spaces
1. The salt of calcium compound used in building constructionis
3. NaHCO3+ HCl ? +? + ?
4. In organic salts aredividedinto and groups.
5. Fill the missingpart?
5.1 CaCO3+ ? H2CO3 +
CaCl25.2 Ca + ? Ca (NO3)2 +H2
heat
5.3KClO3 ? + O2
6. When metal combines with non-metalstheyform compounds.
7. An example of salt that can decay human teethis
8. A table salt has theformula
9. A salt used as medicineis
10. The salt found (deposited) in Afar region is namedas
122
4
IV: Multiple choice item
1. The name of salts formed from sulphuric acid arecalled
A.sulphites B.sulphates C.sulphides D. all ofthese
2. Salts cannot be prepared by one of the following methods.Identify
A. Acidsand bases C. Acids with activemetals
B. Basicoxides D. Decomposition of oxides
3. A salt can be obtainedfrom
A. acidoxides C. peroxides
B. calciumcarbonate D. all of theabove
4. The salt used as a building materialis
A.CaCl2 B. CaCO3 C.KNO3 D. Na2CO3
5. One of the following salts is insoluble inwater.Identify A.
Ca3(PO4)2 B.PbCl2 C. BaSO4 D. All
6. Which formula represents ammoniumwater?
A.NH4NO3 B.NH4OH C.NH4Cl D.(NH4)2CO3
7. Calcium carbonate isused
A. insugarindustry C. in the manufacture ofglass
B. as flux insteelindustry D. all of theabove
8. Chemical combination of phosphorus and metalgives
A. Phosphine B.Phosphides C.Phosphates D. Phosphites
9. Which one of the following is asalt?
A.CaO B.NH4OH C.K2O2 D. FeS
10. The salt used as a laxative and commonly known as Epson saltis
A.MgSO4.7H2O B. BaSO4 C.CaSO4 D. Mg(OH)2
11. Which of the following pairs do produce asalt?
A. Acidand base C. Active metal andacid
B. Metaland non-metal D. All of theabove
12. One of the uses of Na Clis
A. preservingfood C. Making Streetlight
B. watersoftening D. makingfertilizer
13. Which of the following is a binary compound ofsalt?
A.PbBr2 B.NaHCO3 C. CaCl2 D. CaCN2
14. The salt Na2SO3 is produced fromacidand baserespectively.
A. NaOHand H2SO4 C. H2SO4 andNaOH
B. NaOHand H2SO3 D. H2SO3 andNaOH
15. Among the followings, which one is asalt?
A. NH4OH(l) B.NH4Cl(s) C.CH4 (g) D. HCl(g)
16. Identify the salt that does not formed by the combination of an acid and abase?
A.NH4Cl B. HCl C.Na2SO4 D. CaCO3
17. Slats can be classified according to the number of elements they containinto
A. Acid, basic andneutral salts C. Organic and inorganicsalts
B. Acid, basic, neutral andmixedsalts D. Ternary and binarysalts
18. In binary slats the number of elements present couldbe
A. a metal and a non-metal C. a metal and two non-metals
B. twonon-metals D. A and B areanswers
19. Di-ammonium phosphate (DAP) is a salt which has theformula
A.(NH4)3PO4 B.(NH4)HPO4 C.(NH4)H2PO4 D. NH4H2PO4
20. The largest group of inorganic compoundsis
A.Oxides B.Acids C. Salts D. Bases
21. Which of the following is pairedcorrectly?
A. HCl(s)= Salt C. H2O (l) =Base
B. CH3COONa=Acid D. NH4OH (l) =oxide
123
4
22. When metals combine with non-metals usually theyform
A.Acids B.Bases C. Oxides D. Salts.
23. Which of the following is an example of a ternarysalt?
A.CaS B. FeCl2 C. CaCO3 D.HCl
V: Essay type – item questions.
1. Define the following terms and give examples foreach
i) Salt ii)Hydratedsalt iii)Binarysalt iv)Anhydroussalt v) Ternarysalt
2. State briefly three general methods for the preparation of salts and illustrate your answer bya
chemicalequation
3. Name the salts formed when sodium reacts with the following
acids?H2S, H2CO3, HNO3, HCN, HClO3,H3PO4
4. Name the acids and bases that are required to prepare the followingsalts?
i) Potassium sulphate iv) Sodium phosphate ii) Calcium
nitrate v) Zinc carbonate iii) Bariumchloride
5. Name the starting chemicals you would use to prepare each of the followingsalt
i) Calcium carbonate ii)
Silver chloride iii)
Copper (II)carbonate
6. What are the properties ofsalt?
7. Classify the following salts as binary orternary
NaCl, CaCO3, KNO3, CuSO4, HCl
8. Complete the following chemicalequations?
i) HCl + Pb(OH2)
ii) HNO3 +NaOH
iii) NaCl +NaNO3
9. What is the saltof
i) HCl ii)H2CO3 iii)H2SO4 iv) H2S
10. Name the salts that are used asmedicines?
11. Consider salt compounds such as: NaCl2, Na2CO3, CaCO3, KNO3, MgSO4 and AgBr. Which salt
isused
i) as a building and manufacture of concrete ii) in softening hard water iii) as a fertilizer and
fireworks
iv) in cooking in preservingfoods v) as laxative
12. Name the types of oxides that can formsalts
13. What kind of substance can we use to reduce the acidity of asoil?
14. Give examples of binary compounds for thefollowings?
24
1
6
16. Write the name of the acids and bases from which salt is derived Formula
ofsalt Formula ofacid Formula ofbases
NaNO3
Na3PO4
NH4Cl
CaSO4
NaCl
1
25
7
Unit-Four: Human body Systems and Health.
Instruction: attempt all of the following exercises and problems on a separate answer
sheets.
I. True-Falsequestions.
1. Cranium, scapula and ribs are flatbones.
2. Acute gastritis is very serious and dangerous forhealth;
3. Breathing through noise is better than breathing throughmouth.
4. In pulmonary circulation blood flows from lung toheart.
5. Carbuncles are treated with antibiotics and antibacterialwashes.
6. Blister is a skin disease heal by sharp needle with rubbingalcohol
7. Latex allergy is caused by the herpes simplexvirus.
8. Nail covers the internal parts of thebody.
9. The lower part of skin is calledhypo-dermis.
10. Mammary glands produce ear wax forprotection.
11. The function of glands is to regulate bodytemperature.
12. The cuticle has similar function in hair andskin.
13. Pivot jiont is found in theneck.
14. The ball and socket joint permit universalmovement.
15. Knee and elbow joints are examples of glidingjoint
16. Tendons connects muscles tobones
II. Matching itemexercises.
Partone
Column“A” Column “B”
1. Upperlayer A. responsible for the growth of the fingernail.
2. Middlelayer B. white colored half-moon shapedarea
3. Lower layer C. located on the sides of the nailplate
4. Medulla D. located at the base of the nail and overlaps the nailplate.
5. Cortex E. skin that lies beneath the nailplate
6. Cuticle F. part of the nail that isvisible
7. Nail plate G. hypodermis contains fattytissue
8. Nail bed H. middle layer of hairshaft
9. Nailfolds I. deepest layer of hairshaft
10. Lunula J. dermis containing bloodvessel
11. Matrix K. called epidermis made up of deadcells.
Part two.
Column“A” Column“B”
1. Esophagus A. last part of a gut
2. Stomach B. digested food passes through blood vessels
3. Large intestine C. both physical and chemical digestion occurs
4. Small intestine D. end of the digestion products
5. Mouth E. absorbs water
6. Anus F. produces enzymes and hydrochloric acid.
7. Villi G. allows food to pass through.
1
26
7
Part three.
Column“A” Column “B”
1. Acne A. infection caused by the avarice-zoster virus
2. Rosacea B. reaction of proteins found in natural rubber latex.
3. Eczema C. scaly patch on the skin develops from exposing to sun.
4. Hives D. a bubble of fluid under the skin
5. Warts E. caused by bacteria into the hair follicles
6. Cold sore F. a red fluid-filled blister found near the mouth.
7. Carbuncle G. caused by viral infections and seen on hands/feet
8. Blister H. caused by allergic reaction in the body
9. Actinic keratosis I. persistent skin for long range conditions.
10. Latex allergy J. most commonly associated with redness.
11. Chickenpox K. caused when the pores of skin has no oi
Part four:
Column“A” Column“B”
1. Leukemia A. cancer of body‟sblood
2. Osteopaths B. deformation andstereo-malacia
3. Osteoporosis C. bone becomes thin and lose itsstrength
4. Osteoarthritis D. degradation of jointspain.
5. Fracture E. continuity breaks ofbones
Part five:
Column“A” Column“B”.
1. Constipation A. avoiding tobacco and alcoholproducts
2. Diarrhea B. avoiding triggers foods andsmoking.
3. Hemorrhoids C. eating more fruits andvegetables.
4. Gastritis D. taking enough saltwater.
5. Peptic-ulcer E. drinking sufficient amount ofwater.
Part six:
Column“A” Column “B”
1. Inhalation A. combination of food and oxygen inside the body
2. Exhalation B. provide oxygen to reach the blood and CO2 be removed
3. Pharynx C. tiny air sacs where exchanges of O2 and CO2 takes place.
4. Larynx D. major air passage of the lungs/
5. Trachea E. large tube extends from larynx to bronchial tubes.
6. Bronchus F. forms an air passage to the lung
7Alveoli G. a lined cavity connecting nose and mouth to esophagus
8. Lung H. removal of carbon dioxide out of a body.
9. Cellular respiration. I. taking oxygen into the body
1
27
7
Part seven:
1
29
7
Consider the following structures involved in pulmonary circulation.
1. Rightatrium 4.Pulmonaryartery 7. Right ventricle
2. Pulmonary 5.Lungs 6. Left atrium
3. Leftventricle
27. The order of blood flowis;
A.1,7,4,5,2,6,3 C. 6,3,4,5,2,1,7,
B.1,7,2,5,4,6,3, D. 1,6,4,5,7,3,2,
28. Which of the following is part of the smallintestine?
A. Rectum B.Anus C.Colon D.Ileum
29. In the human respiratory system, which of the following parts is nearest to themouth?
A. Larynx B.Windpipe C.Bronchial tubes D. Epiglottis
30. What do we call the joint that allows movement only back andforth?
A. Hingejoint C. glidingjoints
B. Pivotjoint D. Ball and socketjoints.
31. Which of the following is an example of shortbones?
A. Upperarm B. Fingers C. Ribs D. lower arm. 32.
Which of the following statements is true about function ofmuscles?
A. Cardiac muscles cause movement of bones
B. Smooth muscles contract to pumpblood
C. Skeletal muscles allow bodymovement
D. Cardiac and skeletal muscles have similarfunction
33. What are the front chisel-shaped teeth ofhumans?
A. Molars B.Canines C.Premolars D. Incisors
34. What are the cells in our bodies involved in transporting oxygen and CO2? A.Blood cells
B.Musclecells C. Nervecells D. Skin cells
35. Which of the following bones of human skeleton are categorized under the perpendicular skeletonbones?
A. Shoulder B.Skull C. Sternum D. Rib
36. The total number of a mammal having a dentalformula
I=0/2, C=1/1, P=3/3‟ M= 3/3is
A.16 B.32 C. 34 D. 26
37. Cardiac muscles are muscles found in the wallsof
A. Bloodvessels B. Heart C.Stomach D.Intestine.
38. Which of the following is not true about human skeletonfunction?A. protects vital organs
C. Makes new blood cells
B. Produces calcium D. Supports thebody
39. Which of the following type of joint is found at elbow andfinger?
A. Hinge B.Pivot C. Gliding D. Ball andsocket
40. The site of gas exchange between lung and bloodis
A. Bronchi B.Alveoli C.Bronchioles D.Stomach
41. The importance of a valve in blood circulationis
A. To allow blood flow intwodirections C. To allow blood flow towards thelung
B. To prevent back flowof blood D. To prevent mixing ofblood.
42. Blood cells responsible for transport of oxygenare;
A. Platelets andredcells. C. White bloodcells
B. Platelets D. Red bloodcells
43. Which of the following joint is matched with correctexample?
A. Hingejoint---wrist C. Immovable joint---knee
B. Pivot joint---headon neck D. Ball andsocketjoint -----elbow.
44. In human digestive system, pyloric sphincter is foundbetween
A. Small intestine and large intestine C. Stomach and smallintestine
B. Esophagus andstomach D. Pharynx andesophagus
45. Blood pressure is the pressure exerted by the blood on the wallsof;
A. Veins B.Arteries C.Ventricles D. Auricles
1
30
7
46. What are the advantages of breathing thenose?
A. It helps to takeairfaster C. It helps to obtain plenty ofair
B. It needs less energytobreathe D. It warms and filters the air.
47. Axial skeletonincludes--------
A. Bones ofthehips C. Bones of the arms
B. Bones ofthe feet D. Bones of thechest
48. The involuntary muscle whose activity does not stop at all through life is----
A. Smoothmuscle B.Skeletal muscle C.Cardiacmuscle D. Straightedmuscle.
49. The alveoli are efficient respiratory surfacesbecausethey -------- ;
A. Have smallsurfacearea C. are notventilated
B. Lackblood vessels D. have walls single cell thick.
50. Which heart chamber has the thickest wall?Why?
A. Right ventricle, because it pumps blood to thelungs
B. Left ventricle, because it pumps blood throughout thebody
C. Left auricle, because it pumps blood to leftventricle
D. Right auricle, because it pumps blood to leftventricle
51. The blood is enriched with oxygen supplyduring---------
A. Systematiccirculation C. Renalcirculation
B. Pulmonarycirculation D. Portalcirculation
52. Respiration infections can be avoided by the followingsexcept
A. Eating balancedmeals
B. Sufficient ventilation of places where tostay
C. Avoiding to stay around over-crowdedplaces.
D. Cleaning the skin usingsoap.
53. The human heart and lungs are protectedby;
A. Appendicularskeleton B.Skullbones C.Ribsbones D. Hip bones
54. HIV primarilyattacks;
A. Redbloodcells B. Blood platelets C. Whitebloodcells D. Blood plasma
55. The main function of the large intestine isto;
A. Absorbwater B. Absorb fatty acids C.digest protein D. Digestcellulose
56. Compared with inhaled air, exhaled aircontains
A. Lesswatervapor B. More carbon-dioxide C.moreoxygen D. lessnitrogen.
57. One of the following is not the function ofskin?
A. Excretoryorgan C. Controlling body temperature B.
protect against lossof water D. Keeping balance and bodyorientation
58. Which of the following is not the function of epidemic ofskin?
A. To reduce excesswaterloss C. to protect from sunrays
B. To protectofdiseases D. to protect from loss of excessheat.
59. The part of hair which is characterized by regulating body temperature is;A.Cortex B. Cuticle
C.Medulla D. Epidermis.
60. A type of exocrine gland which produce ear wax for protection iscalled
A. Mammarygland C. Sudoriferous
B. Ceruminouegland D. Sebaceous gland
61. Which of the following components of integumentary system is not correctly matched with itsfunction?
A. Glands--excrete differentchemicals
B. Nail --- protect organisms frominjury
C. Humanhair -- traps warm air between skin andhair
D. Humanskin ----release oil in to hairfollicle.
62. A skin disease which is treated with antibiotic and anti-bacteria washesis
A. Blister B.Carbuncle C.Warts D. Chickenpox
63. The followings are functions of the skeletal systemexcept:
A. Movement B.Protection C.Support D. Transportation
1
31
7
64. Which of the following can be the cause for loss of musclebone?
A. Musculardisorder B. Malnutrition C. Lackofexercise D. All ofthese
65. Which one of the following is a correctpair?
A. Cardiacmuscle-----arm C.Smoothmuscle------ shoulders
B. Skeletalmuscle-----intestine D. None of theabove
Essay type exercises
1. What is digestive system? What are its mainfunctions?
2. List all the components of alimentary canals inorder
3. What is meant by physicaldigestion?
4. Write at least two important jobsof
I. Bile ii.Largeintestine iii. Smallintestine
5. Where does digestion starts? Ends in humanbody
6. What the role of the human skeletalsystem?
7. What is roughage? What is theiruse?
8. What is the dental formula of adult human? Giveexample
9. What is respiration? List its parts in orderof
10. Write the uses of the following nose partsof;
I. Hair ii. Largesurfacearea iii. Mucus iv. Good bloodsupply
11. What are the causes of the following diseases of respiratorysystem?
I. Asthma ii.Sinusitis iii.Influenza iv.Bronchitis
12. Which type of bone is composed of scapula &clavicle?
13. What is the products function ofBile?
14. Why is breathing through nose much better than throughmouth?
15. Give examplesfor
I. Immovablejoints ii.Movablejoints iii. A pivotjoint
16. What is a bone? Write its types withexamples?
17. List some skeletal system diseases? What is itsprevention?
1
32
7
II. Systematic circulation and pulmonary circulation 26.
Write three parts of our body where non-movable joints are found?
27. Write three types of axialskeleton?
28. Label the parts of heart and define theirfunctions?
1
33
7
Part three
Column“A” Column “B”.
1. Gonorrhea A. movement of eggs from ovary to Fallopiantube
2. Cancroids B. discharging of blood throughvagina.
3. Syphilis C. damages the immune system of white blood cells
4. HIV/AIDS D. caused by bacterium.
5. Menstruation E. caused by hemophiliacs
6. Ovulation F. caused by treponema palladium
7. Menopause G. stopping of menstruation and ovulation in female.
A. The growth of hair on the face in males C. The presence of penis and tastes in males
B. The production of egg cells in females. D. The enlargement of genital organs in females.
14. The male reproduction structure that helps to lower the temperature of the testesis;
A. Penis B.Scrotum C.Epididymis D. Prostategland.
15. Contraceptive pills helps in birth controlby;
A. Preventing growth oftheembryo C. Preventing the implantationprocess
B. Blocking the passage ofthesperm D. preventing the process ofovulation.
16. Which of the following is true about the menstrualcycle?
A. It takes a longer timeaftermenopause C. Its secretory phase involves loss ofblood
B. It starts in femalesatpuberty D. It takes a shorter time duringpregnancy
17. Which of the following secondary sexual characteristics is common for males andfemales?
A. Deepeningof voice C. Widening ofhips
B. Enlargementofbreast D. Fast bodygrowth
18. In which parts of a human reproductive system fertilization takesplace?
A. Oviduct B.Ovary C.Cervix D.Uterus
19. Which of the following processes found in human reproductive system is different from theothers?
A. Fertilization B.Ejaculation C.Menstruation D. Ovulation
20. HIV can be transmitted by all of the following routes of transmissionexcept;
A. havingunsafesex C. using contaminatedneedles
B. feeding onbreast milk D. biting bymosquitoes
21. Which of the following is true about menopause? It is the age that marksthe;
A. endofgivingbirthinmale‟s C. beginning of menstrualcycle
B. end of giving birthinfemales D. beginning of sperm cellproduction.
22. Which of the following is not the member of primary sexual characteristics of themale?
A. penis B.Testicles C. Scrotum D. Uterus
23. The process by which a fertilized egg is embedded in the wall of uterus iscalled
A. Ovulation B.Implantation C.Fertilization D. Placenta
24. The test is normally descendedintothe .
A. Penis B.Uterus C.Scrotum D. Ovary
25. Which of the following is false aboutmenstruation?
A. It is a monthly dischargeofblood C. It begins at pubertystage
B. It is the characteristic of both maleandfemale D. It occurs if fertilization does not takeplace.
26. Which of the following is not a common sexually transmitteddisease?
A. Syphilis B.Gonorrhea C.Cancroid D. None.
V. Essay type exercises andproblems.
1. Define the following terms withexample.
A. testosterone C.menopause E.ovulation G.rape
B. estrogen D.ejaculates F.Graafianfollicle H. HIV/AIDS
2. List those of secondary sexual characteristicsof
A. Male B. Female
3. What are the two hormones of male andfemale?
4. Explain the importance of reproduction inhuman?
1
35
7
5. Write the common sexual characteristic of male andfemale?
6. What is meant by primary sexualcharacteristics?
7. What are the hormones produced during puberty of female? What are theirimportant?
8. Draw the male reproductive organs andthen
A. Labeleachpart. B. Write theirfunctions.
9. List all the problems affect the reproductive health ofwomen
10. For the following diseases write their causes, transmission and prevention.(make atable)
A. HIV B.Syphilis C. Gonorrhea D.Cancroids
11. What are the rules (ABC ) to abstain from sex beforemarriage?
12. What is menstrual cycle? How itoccurs?
13. Write the two types ofabortion?
14. For the following picture, write the name of the indicated numbers and define theirfunction?
1
36
7
II. Matching itemquestions.
Part one;
Column“A” Column “B”
1. Mutualism A. studies about interaction between organisms and theirhabitat.
2. Commensalism B. the sum of all living and nonliving components in a givenhabitat
3. Parasitism C. biological association between two organismsinteraction.
4. Protocooperation‟s D. two populations compete for resources and areharmed.
5. Competition E. cannot make foods and feed on otherorganism.
6. Autotroph F. an obligatory relations oforganisms
7. Heterotrophs G. relation in which one organism is benefited and other isharmed.
8. Symbiosis H. both populations compete and both areharmed
9. Environment I. organisms that can synthesis their own energy from rawmaterials.
10. Ecology J. Relation in which both organism arebenefited.
Part two:
Column“A” Column “B”.
1. Consumers A. composed of several gases and watervapor
2. Water B. important for the growth ofvegetation
3. Sunlight C. simple feeding system involves in transfer of nutrient andenergy
4. Air D. organisms that make their ownfood
5. Soil E. found at the end of each food chain due tocharacter
6. Decomposer F. a complex feeding system which consists of many foodchains
7. Landtopography G. serves as a habitat and irrigation
8. Food chains H. source of energy for all life onearth.
9. Food web I. cycle of elements from environment to organism and back toenvironment
10. Nutrientcycle J. the arrangement of landescape.
11. III. Fill in the blankspaces.
1. Organisms which release energy from chemical reactions iscalled
2. Plants that drive its moisture and nutrients from air, rain and grow on other plants arecalled
3. A relationship where one organism gets benefits is referred asto
4. An organism which cannot make its own food iscalled
5. An organism that uses sunlight to synthesis organic foods isknownas .
6. An organism that is carnivores and depends on consumers isknownas .
7. Any type of biological associations between two organisms thatinteractis .
8. A relationship in which one organism gets benefit while the other is notreferredto .
9. The major components forecosystemare and .
10. The hydrogen cyclebeginsfrom where as oxygen cyclestartsfrom .
11. A graphical representation of the energy found within the trophic levels of anecosystemis known
as
12. The conversion of ammonia to nitrates by soil living bacteriaiscalled .
13. The main driving factor of the oxygen cycle is theprocessof .
14. The elements that are most important for plants nutrientsarenitrogen, and
15. Animals that eat both plants and other animals arecalled
1
37
7
16. The original source of energy in an ecosystemis
17. A population and an environment in which its members interactforming
18. A complex feeding inter relationship among organism isknown as .
IV. Multiple choice itemquestions.
1. In the pyramid of biomass, which of the following trophic levels has the highestbiomass?
A. Herbivores B.Producers C. Carnivores D. Secondarycarnivores.
2. Which of the following symbiotic relationships is notobligatory?
A. Protocooperation B.Parasitism C. Mutualism D. Commensalism
3. To which tropic level do primary consumersbelong?
A. First B.Second C.Third D. Fourth
4. The association of different species of organisms interacting and living together iscalled
A. Community B.Ecosystem C.Population D. Habitat
5. Which of the following groups form the base of an ecologicalpyramid?
A. Decompose-rs B.Producers C. Secondaryconsumers D. Primaryconsumers.
6. An ecosystem will most likely remain stableif
A. Finiteresourcesdecrease C. It has more predators thanprey
B. Bioticfactorsdecrease D. It has a high level of biodiversity
7. An ecological unit which is self-sufficient in its energy and nutrient requirementsis
A. Population B.Ecosystem C.Biosphere D.Community
8. The pair of processes which return carbon dioxide to atmosphereare‟
A. Decompositionandphotosynthesis C. Photosynthesis and respiration
B. Evaporationandrespiration D. Decomposition andrespiration.
9. Which one of the following is not an abiotic component of anecosystem?
A. Food B.Sunlight C. Rainfall D. Wind
10. Animals which feed on meat left by predator arecalled--------
A. Scavenger B.Decomposer C. Saprophyte D. Herbivore
11. In tropical rain forests, epiphytes grown on the branches of large trees. This is an exampleof;
A. Commensalism. B.Parasitism C. protocooperation D. Mutualism
12. Which of the following is correct about pyramid ofenergy?
A. Carnivores < herbivores<producers C. Omnivores< producers<carnivores
B. Producers < carnivores<herbivores D. Herbivores < carnivores <producers.
13. In a simple food chain, secondary consumersoccupy
A. Secondtrophic level C. fourth trophiclevel
B. First trophiclevel D. third trophiclevel.
14. Which of the following is true about the pyramidenergy?
A. Energy is lost in a food chain at various trophiclevels
B. Primary consumers are large in number thanproducers
C. The biomass of carnivores is greater thanherbivorous
D. Organisms at higher trophic levels contain more energy than organisms at lower trophiclevels.
15. Ecology is a biological science that deals with all of the followingexcept
A. Ecosystem B. Population C.Anorganism D. Community.
16. Biodiversity refersto;
A. All the natural resources we have on the planetearth
B. The variety of living things on the planetearth
C. Sustainable use and protection of naturalresources
D. Identifying and scientifically describing species of livingthings.
17. Organisms that get energy from the breakdown of inorganic substances arecalled
A. Autotrophs B.Heterotrophs C.Chemotropism D. Omnivores.
18. In a given food chain, cow is found atthe
A. 1sttrophic level B. 2ndtrophic level C. 3rdtrophic level D. 4thtrophiclevel
19. According to the pyramid of biomass, which of the following groups of animals has the highestbiomass
20. A.Dog B. Lion C. Sheep D. Hyena
1
38
7
21. In a given pyramid of energy, which of the following groups of organisms has the lowestenergy?
A. Grass B.Horse C.Tiger D.Ox
22. All the organic materials produced by living organisms isknown.
A. Food web B. Foodchain C.Biomass D. Biofuel
23. Which of the following can be considered as abiotic component in a givenecosystem?
A. The number ofparasitesdiseases C. The amount of foodavailable
B. The type of soilsandrocks D. The number ofpredators.
24. Which of the following group organisms eats otherorganisms?
A. Prototroph B.Chemotropism C.Heterotrophs D. Autotrophs
25. Which of the following food chains iscorrect?
A. Grasshopper → leopard → rodentC. Algae → parrot fish →grouper
B. Corn → grouper → parrotfish D.Algae → corn → parrotfish.
26. An ecosystemincludes
A. one typeof organism C. two types oforganism
B. At least one type of plant and one typeof animal D. a wide variety oforganisms
27. What kind of organisms can produce their ownfood?
ACarnivores B. Animals C.Greenplants D. Herbivores.
28. What name is given to all organisms that feed on otherorganisms?
A. Producers B.Consumers C.Decompose-rs D. Carnivores
Answer question number 28 and 29 based on the diagrambelow.
1
22
29. In the pyramid energy producers are found in the trophic level 3
Designated by number:A.4 B. 3 C. 2 D. 1
30. The least amount of energy is delivered from the trophic level3 4
Designated by: A.1 B. 2 C. 3 D.
4Questions number 30 up to 32 is based on the food chainbelow;
Grass Grasshopper Frog Snake
31. In such food chain, the primary consumeris;
A. Snake B.Grass C. Grasshopper D. Frog.
32. Which organism takes the third trophiclevel?
A. Frog B.Snake C.Grasshopper D. Grass
33. In the above food chain, Grass is:
A. Autotrophs C. PrimaryConsumer
B. Secondaryconsumer D. Second trophiclevel.
34. Which one of the following has a uni-directional flow in anecosystem?
A. Energy B.Nitrogen C.Carbondioxide D. Phosphorus.
Answer questions 34---36 based on the figure below. Note that the arrow shows the direction of energy
flow.
Hawk
Fox Snake
Small bird
Cater pillar
Green plant
1
39
7
35. Which animal has many alternatives to feedon?
A. Hawk B. Fox C.Snake D. Filed mouse.
36. Which of the following is false about thefigure?
A. Hawk, fox, snake,arecarnivores C. Fox is 2ndand 3rdconsumer
B. Hawk is 2nd, 3rdand4thconsumer D. Field mouse is primaryconsumer.
37. Which animal supports manyconsumers?
A. Rabbit B.Small bird C.Filedmouse D. Cater pillar.
V. Essay typeexercises.
1. Define the followings inbrief
I. Ecology III.Nutrient cycle V.Pyramidenergy VII. Nitrification
II. .Environment IV.Decompose-rs VI.Heterotrophs
2. Explain why is the number of organisms in each group decreases from bottom totop?
Write the componentsof;
I. Food chain II.Food web III.Biotic IV. Abiotic
3. Write the differences between thefollowings?
I. Food chain andfoodweb III. Intra-specific interaction and inter-specificinteraction.
II. Producer and consumers
4. Construct your own food chain in the followingtable.
Producer 1storder 2ndorder 3rdorder 4thorder
consumer consumer consumer.
consumer
1.
2.
40
3
2
II. Fill in the blankspaces.
1. The loos surface material that covers most landiscalled 2.
A dark ,soft and rich in nutrients decaying organic mattersis
3. The types of soilsaresandy, and .
4. The type of soil that has poor ability to hold wateris
5. The type of soil which is suitable for growing plantsis
6. The method of preventative soil that help for improvement of soil structure and fertilityis
7. Chemicals used to destroy the weed plants areknownas .
8. The method used to absorb and hold water and reduces the run offis
9. Air is madeupof % of nitrogenand % of oxygen.
10. AnaturalprocessthatwarmstheEarth‟ssurfaceis .
11. An area set aside for the preservation of the natural environmentis
12. The process of growing trees to prevent soil erosionis
13. The collection of shrubs and large trees arecalled
14. The collection of life and habitat in ecosystem isknown as .
15. The maintenance of species and ecosystems is conserved by two ways. Theseare
and .
III. Multiple choiceexercises
1. Which of the following gases results in global warming when accumulated in theatmosphere?
A. Carbondioxide B.hydrogen C.Oxygen D. Nitrogen.
2. Which of the following activities increases the biodiversity of ourcountry?
A. Cutting treesfortimber C. Burning of fossilfuels
B. Replantingofforests D. Cultivation of a singlecrop.
3. Air pollution by chlorofluorocarbons(CFCs) hascaused
A. Ozone hole B.Globalwarming C. Acid rain D. Volcano eruption.
4. Which of the following refers to the topography of anecosystem?
A. Climatefactor B.Bioticfactor C.Seraphicfactor D. Physio-graphicfactor.
5. Which of the following play an opposite role in recycling carbon between living things and theenvironment?
A. Condensationandphotosynthesis C. Evaporation and condensation
B. Respirationandcombustion D. Photosynthesis and respiration.
6. What is the role of nitrifying bacteria in the nitrogencycle?
A. Produce nitrates for the usebyplants C. Decompose dead bodies of plants andanimals
B. Build free nitrogen intheirbodies D. Release free nitrogen toatmosphere.
7. Ammonium compounds are oxidized to nitrateby;
A. Nitrogenfixingbacteria C. nitrifyingbacteria
B. Denitrifyingbacteria D. putrefyingbacteria.
8. What do we call the place where organisms live in theirecosystem?
A. Abiotic b.Biotic C.Habitat D. Niche
9. Which of the following element is not recycled in theecosystem?
A. Carbon B.Sulphur C.Energy D. Oxygen
10. Which of the following element is the most abundant in livingthings?
A. Nitrogen B.Carbon C.Oxygen D.Hydrogen.
11. Which of the following processes is most important to release nutrients from dead organic matter into thesoil?
A. Respiration B.Decomposition C.Excretion D. Fixation.
12. Which of the following activities is used to conserve ourvegetation?
A. Plantingexoticplants C. Protecting naturalresources
B. Encouragingdeforestation D. Reducing indigenousplants.
13. What is the significance of plantingtrees?
A. To reduce the numberofwildlife C. To reduce the rate of soilerosion
B. To reduce the number ofsoil microorganism D. To increase the amount of carbondioxide.
341
3
14. Which one of the followings is a renewableresource?
A. Fossil fuels B.Coal C. Livestock D.Gold.
15. Which of the following processes removes CO2 from theatmosphere?
A. Respiration B.Burning C.Decomposition D. Photosynthesis.
16. Which of the following processes occurs during carboncycle?
A. CO2 is released to the air duringphotosynthesis
B. CO2 is removed from the air during burning offossils
C. CO2 is released to the air duringdecomposition
D. CO2 is removed from the air duringrespiration.
17. Which of the following activities causes globalwarming?
A. Burning offossil fuels C. Reducing the number of livestock
B. Afforestation ofthehabitat D. Reducing the amount of ricefarms.
18. Which of the following statements is correct about the importance of conservation in a givenecosystem?
A. It maintains healthy biodiversity in theecosystem
B. It maintains pure air and water in theecosystem
C. It reduces the biodiversity from theecosystem
D. It gives favor for single species in theecosystem.
19. Which of the methods is used to conservewildlife?
A. Mixing wildlife with thedomesticspecies C. Shifting their habitat andniche
B. Allowing poaching foreconomical use D. Setting national parks andsanctuaries.
20. Which of the following statement describes renewableresources?
A. They can be used but unable to bereplaced
B. They are mainly nonliving andreplaced
C. They are mainly living things and theirproducts
D. They can be replaced but unable to bereused.
21. Which of the following statements is correct about the nitrogencycle?
A. All bacteria in the soil are helpful in nitrogencycle
B. Denitrifying bacteria in the soil convert nitrogen intonitrates.
C. Green plants absorb nitrogen in the form ofammonia
D. Nitrogen fixing bacteria in the soil convert nitrogen intoammonia
22. The wise use of natural resourceis
A. Degradation B.Misused C.Destruction D. Conservation.
23. One of the following explains the importance of wild animals. Identifyit.
A. Maintains the balanceofnature C. Source of industrial rawmaterial
B. Source of food D. All arecorrect
24. Which of the following is more likely to ensure the conservation of all therest?
A. Soilconservation C. Plantconservation
B. Wildlifeconservation D. Watershedconservation.
IV. Essay type review exercises andProblems.
1. Define the followings withexamples.
I. Naturalresources III.Renewableresources V.Biodiversity
II. Airpollution IV.Resourcemanagement VI.Conservation
2. Group the followings into renewable or nonrenewable resources ( soil, minerals, fuels, gold, air,
forest, plants, petroleum, water,coal,)
3. Write those characteristicsof
I. Soil II.Water III. Air
4. Write the impacts of;
I. Airpollution II.Waterpollution III. Global warming.
5. What are the major causesfor
I. Airpollution III. Water Pollution
II. Deforestation V. Global warming
3 42
4
6. Write the main usesof
I. Soil III.Air V. Carbon dioxide
II. Forest IV.Water
7. List down the various actions that can betaken
I. To conserveforests
II. To reduceairpollution III. To reduce the emission ofCO2.
8. What are the strategies usedto
I. Soil conservation II.Waterconservation III. Biodiversityconservation
9. Write the differencesbetween
1. Respiration andtranspiration 2. Sanctuaries and nationalpark
10. List down the uses ofBiodiversity
11. What is meant by indigenous knowledgeconservation?
12. What is aquarium? Giveexamples.
13. List the types of diseases that are dangerous for human health dueto
I. Airpollution II. WaterPollution
Unit Six-Solar system.
I. True-False item typequestions
1. Pluto is the biggest planet of the solarsystem.
2. Everything in the solar system revolves around theearth
3. Artificial satellites revolve around thesun
4. The solar system consists of nineplanets.
5. Mars is a planet that has suitable conditions for life tolive
6. The tail of a comet is always directed towards thesun.
7. Planets revolve around thesun.
8. Asteroids closest to the sun are rockyobjects.
9. Meteoroids are small objects moving around theEarth.
10. The earth has a strong magneticfield
11. The sun does not rotate on itsaxis.
II. Matching item questions.
Partone:
Column “A” Column “B”
1. Sun A. the planet known as the red planet.
2. Moon B. have highly elliptical orbits
3. Venus C. a natural satellite to earth.
4. Saturn D. the smallest planet of all
5. Earth E. the planet that has a ring
6. Pluto F. the farthest planet in the solar system
7. Jupiter G. the biggest planet of all
8. Mercury H. the most massive object in solar system
9. Uranus I. the first plant discovered and has a blue-green in color
10. Mars J. planet that has only one moon.
3 43
4
Part two:
3
46
8
11. Real images are alwaysinverted
12. In a plane mirror, the size of the object and the image formed is thesame.
13. Virtual images can be replaced on ascreen
14. A shadow , which is formed behind, is an opaqueobject
II. Matching itemquestions.
Column“A” Column “B”
1. Light A. objects that absorbs light withouttransmission.
2. Sourceoflight B. light reflects from unpolishedsurface
3. Refractionoflight C. objects that can produce their ownlight
4. Dispersionoflight D. objects allow light to pass throughthem
5. Transparentmaterials E. light reflects from smoothsurface
6. Translucentmaterial F. objects which do not emitlight
7. Luminous G. objects which allow light partially throughthem
8. Non-luminous H. splitting of white light into its constituentcolors.
9. Regularreflection I. light rays bend when it goes from one medium toanother.
10. Diffusereflection J. objects emits light of its own.
11. Opaquematerials. K. form of energy enables to seeobjects.
III. Fill in blankspaces.
1. Lightisa that enables to seeobjects
2. Objects which emits its own light iscalled
3. The two types of source oflight are and
4. The bending of light rays as it travels from one medium to another isknown as .
5. The change in direction of light as it moves from one medium to anotheriscalled .
6. The major factors which are required forvisionare and .
7. Images are formed by an imaging toolcalled
8. In plane mirror an image is formedby
9. Real imageisalways , but virtualimageis .
10. The two types ofreflectionare and
11. A ray of light that strikes the surfaceiscalled .
12. We see objectseitherby orby .
13. The light from the sun comes toearthby .
IV. Multiple choicequestions.
1. Which one of the following is different from theother?
A. Moon B. Sun C.Torchlight D. Burningcandle
2. The bending of light rays from one medium to another iscalled
A. Reflection B.Refraction C.Diffraction D. None
3. The nature of the image formed by a plane mirroris
A. Real B.Enlarged C.Inverted D. All
4. The image formed in a plane mirroris
A. Real and the same size astheobject C. virtual and the same size as theobject
B. Real and nearly the same size as the object D. virtual and nearly the same size as theobject.
5. The splitting of white light into different colors iscalled
A. Reflection B.Refraction C. dispersion D. Diffraction.
6. An image that cannot be obtained on a screen iscalled
A. Realimage B.Virtualimage C.Invertedimage D. Magnifiedimage.
7. The splitting up of light into colors of the spectrum on passing a glass prism isknown as A.
Reflection of light B. Dispersion of light C. Refractionoflight D. Image formation.
8. One of the followings is due to reflection oflight:
A. Dispersionbyprism C. Image formation by planemirror
B. Image formationbyeyes D. Mirage formation during hotdays.
3
47
8
9. The human eye form the image of an object atits;
A. Iris B.Pupil C.Retina D. Cornea
10. The color of an opaque object is the color of the light thatis;
A. Transmitted B.Reflected C.Refracted D.Absorbed
11. A rain bow is formedby;
A. Reflection B.Refraction C.Absorption D.Transmission
12. A stick held in a pond appears to be at the surfacebecause
A. Light travels faster in water than inair
B. Light travels faster in air than inwater.
C. Rays of light from the eye bend intowater
D. Rays of light are bent away from the normal at thesurface.
V. Essay type exercises andproblems:
1. Classify the followings as transparent, translucent or opaquesubstances.
(metal sheet, waxed paper, wood sheet, wall, glass, stone, clean water, fogy air, clean plastics, air,
oiled paper, frosted glass and tissue paper)
2. Define the followingterms;
I. Realimage III.Virtualimage V. Luminousbody
II. Refraction IV.Dispersionreflection VI.Reflection
3. List down the properties oflight
4. How many colors does a rain bowhold?
5. In the dispersion of white light by prism; I. What color is bent themost?
II. What color is bent theleast?
III. Which color is bent themedium?
IV. Write the colors in order ofappearance?
6. What is meant by spectrum of whitlight?
7. From the figure, what do youunderstand?
8. When does lightbend?
9. Draw how the incident rays and the reflected rays reflecton
I. Smooth surface II. Roughsurface.
10. Write three examplesof;
I. Natural sourceoflight II. Artificial source oflight.
11. Give at least three examplesfor;
I. Luminousobjects II. Illuminesobjects
12. Explain how image isformed:
I. Inplanemirror II. In humaneyes
13. Draw the incident and reflected raysfor
I. Refraction oflight,
II. Reflection oflight.
III. Dispersion of white light by aprism
14. Complete the following diagrams for light rays passing from one medium toanother
3
48
8
Review Exercises and problemsonsound I.
True-False itemquestions.
1. As temperature rises, the speed of sounds in air is alsoincreased.
2. Echoes are caused by the reflection of soundwaves.
3. A body can produce sound when itvibrates.
4. Sound is better transmitted in air than insolids
5. When objects collide with each other they producesound.
6. Echo is used to determine the position of the soundreflector.
7. The speed of sound in materials is thesame.
8. People working in noisy areas should wear ear plugs. II. Matching itemquestions.
Column “A” Column “B”
1. Sound produced A. the reflection of sound waves
2. Source of sound B. Unpleasant sound to hear in the environment.
3. Vacuum C. substance through which sound is transmitted.
4. Sound pollution D. vibration of an object
5. Echo E. sounds which are pleasant to hear
6. Medium F. Sound does not travel
G. musical instruments
III. Multiple choicequestions.
1. Sound does not depend up on which of thefollowing
A. Temperature B.Distance C.Medium D. Vacuum
2. The increase order of hearing sound isin
A. Gas,liquid,solid, C. Solid, liquid,air,
B. Liquid, air,solid, D. Air, Steel,water,
3. The three requirements for sound to be heard can be written in orderof;
A. Source, mediumandear C. Medium, Source and water
B. Ear, mediumand source D. Source, medium and Receiver 4.
Sound cannot travelthrough;
A.Air B.Vacuum C. Water D. Steel.
5. Sound can be heard clearlyduring
A. Nighttime B.Daytime C.Anytime D. Rainingseason.
6. An echois
A. Formed during thunderstorm heard in a claimair
B. A reflection ofsound
C. Heard at minimum distance of 10meters.
D. None ofthese
7. Sound can be:
A. Transmitted B.Absorbed C.Reflected D. All ofthese
8. Which statement is wrongly stated aboutsound?
A. Sound travels inall direction C. Sound travels faster thanlight
B. Sound is a formof energy D. Sound cannot travel invacuum
9. Sound is better absorbedin
A. Air B.water C. Vacuum D. Solids
10. As temperature rises, the speed of sound inair
A. Decrease B.Increase C.Remain Constance D.None
11. An echo isused;
A. To measure the speed of soundinair C. To determine the source ofsound.
B. To measure the depth ofthesea D. All of the above.
3
49
8
12. Which one of the followings is a stringinstrument?
A. Kirar B.Washint C.Kebero D. all
13. What does the outer ear do to soundwaves?
A. Scatterthem B. Gatherthem C.Amplifythem D. Convert them.
14. The property of a sound wave that is related to the loudnessis
A. Thewave length B.Theintensity C.The speed D. Thepitch
15. Which of the following decibels (dB) level will harm to humanears?
A. 60dB B. 80dB C.120dB D. 40dB.
16. Which of the following is the application of anecho?
A. Inastethoscope B.soundboard C.Hearingaids D. All.
17. Which one of the followings is true aboutsound?
A. Speed of sound in air decreases with temperature C. Sound requires material media topropagate
B. Sound travels faster in air thaninsolids D. Sound travels faster than light inair.
IV. Essay typequestions.
1. Explain how sound isproduced?
2. What issound?
3. Why sound cannot travel throughvacuum?
4. What does a sound need totravel?
5. When you touch a source of sound, what do youfeel?
6. Mention some practical application ofecho?
7. Why is sound travel more quickly through solids thangases?
8. List some cause of soundpollution?
9. What are the effects of soundpollution?
10. List the steps to reduce soundpollution
11. What are the average decibels (dB) forhearing?
12. List those hazards or causes when you expose to Strongnoise?
13. The sound of a patient heart beat can be measured by instrumentknownas .
14. Consider water, steel, vacuum and air. Which of thesesubstances
I. That soundcannottravel II. Are best transmitters of sound
15. Why should trees be planted aroundbuildings?
Review exercises on Heat, Simple circuit andmagnetism.
I. Fill in the blankspaces
1. Heat flowsfroma to body.
2. Transfer of heat that occurs without any medium materialis .
3. Poor conductors areknown as .
4. The transfer of heat by the movement of a fluid iscalled
4. In all solids, heat is transferred bytheprocess .
5. The electric circuit symbolfor
I. Resistoris III. Batteryis
II. Cell is
6. A device for closing or opening the flow of current in circuitis
7. A material that cannot pass current through itis
8. A device that controls the flow of current in electric circuit isknownas .
9. Heat can transfer throughsolidsby and throughvacuumby .
10. The branch of physics which deals with the property of a magnetiscalled .
11. of a magnet repel each other, but unlike poles of amagnet
12. Inside the magnet, the field of linespointfrom to pole.
13. The amount of heat energy in matter dependsupon and 14. The
direction of heat flow from one substance to the other isdeterminedby .
14. Heat will flow if the temperatures of twobodieshave .
4
50
2
II. Matching itemquestions.
Part one:
Column“A” Column “B”
1. Heat A. substances do not allow heat energy to be transferred throughthem
2. Conductors B. a form of energy flowing from higher body to lowerbody
3. Insulators C. the transfer of heat from a hot object to a coldobject.
4. Heattransfer D. energy transferred from the end by contact to otherend.
5. Conduction E. substances allow heat energy to be transferred throughthem.
6. Convection F. transfer of heat without material medium between twoobjects
7. Radiation G. transfer of heat by the movement of theliquid.
Part two
Column“A” Column “B”
1. Open circuit A. breaks the circuit or start the flow of current
2. Closed circuit B. a device that slows the flow of electrons.
3. Electric cell C. device which glows and emits light
4. Cell D. a source of current electricity
5. Resistor E. a combination of two or more cells.
6. Switch F. a bulb and wire form a complete path.
7.Battery G. a bulb does not lightup.
III. Multiple choicequestions
1. The SI unit of Heatis;
A. Joule B.Pascal C.Watt D. Calorie
2. Which of the following is true aboutHeat?
A. Heat measures the hotness or coldness C. Heat is a form of energy.
B. Heat flows from hot body to cold body D. Heat decreases the temperature of a body.
3. Magnets are not used in constructionof
A. Batteries B.Generators C.Electricmotors D. Electricbulbs
4. When something gets hotter, the particles in it gainmore;
A. Chemical energy B.Kineticenergy C.Potentialenergy D. thermalenergy
5. The heat energy from the sun is transmitted to the earthby
A. Transmission B.Conduction C. Convection D.Radiation.
6. The following sources of heat convert chemical energy to heat energyexcept‟
A. Dungcake B. Firewood C.Kerosene D. Electricitymains.
7. What causes you get warm if you stand near afire?
A. Conduction B.Radiation C.Convection D.Transmission
8. Electricity will only flow through a circuit if the circuitis;
A. Closed B. Connectedinseries C. Connectedinparallel D. Open
9. In a circuit, how do electronsmove?
A. From positive to negative, through aconductor.
B. From negative to positive, through aninsulator
C. From positive to negative, through aninsulator.
D. From negative to positive, through aconductor.
10. In an electric circuit, which one is used to break thecircuit?
A. Battery B.Generator C.Switch D. Copper wire.
11. Identify the household item that does not use a magnet as itscomponent;
4
51
2
A. Radioloudspeaker B.Electricitymeter C. Thermoflask D. Electricstove
12. Which of the following statements is correct aboutconductors?
A. Conductors havefreeprotons C. Conductors have free electrons B.
Conductors lackfreeelectrons D. Conductors have excessprotons.
13. Which element is a semiconductor?
A. Copper B.Aluminum C. Sulphur D. Germanium.
14. What is the use of a “fuse” in homeinstallation?
A. Toincrease current C. To control over flow ofcurrent
B. Todecreasecurrent D. To switch on and offautomatically.
15. A device used to measure potential difference or voltageis
A. Ammeter B.Volt C.Voltmeter D.Electroscope.
16. The region of a magnet where the magnetic field is felt very strong;
A. At all parts ofthemagnet C. At the poles of themagnet
B. At the sides ofthemagnet D. Cannot bedetermined
17. Which of the following is not true?
A. There are metals that are not attracted bymagnet
B. Heating a magnet tends to weakerit
C. Some magnets have only onepole
D. A magnet cut in half will produce two completemagnets.
18. All of the following substances can attract a magnetexcept;
A. Copper B.Iron C.Nickel D. Steel
19. The arrows on the magnetic lines of forcerepresent
A. The strength ofthefield C. the magneticforce
B. The magneticfielddirection D. the magnitude of magneticfield
20. Inside the magnet, lines of forces are directedfrom
A. NorthtoSouth B. SouthtoSouth C. South toNorth D. North toNorth
21. A region where magnetic force is strong iscalled--------
A. Magneticfieldlines B. Magnetic field C.Magneticpole D. Magnet
22. The magnetic field is stronger when the fieldsare
A. Opposing B.Helping C. Helping-Opposing D. None ofthese
23. One of the followings is best to lift heavy magneticmaterials;
A. Barmagnet B.Electromagnet C. Horseshoemagnet D. All ofthese
24. A freely suspended magnet always points inthe
A. North-Southdirection C. East-Northdirection
B. North-Westdirection D. South-North direction
25. Which of the following is not the use of amagnet?
A. Makingcompasses C. Scanningmachines(MRI)
B. Maglevstrains D. None ofthese
26. Which of the following is not the property of magnetic fieldlines?
A. The magnetic field lines intersect oneanother
B. The two poles of a magnet always exist inpairs
C. The magnetic field is strongest near the endpoles.
D. The magnetic field lines point from S-to-N pole inside themagnet.
27. Which of the following substance does not change when heat isapplied?
A. Densityofmatter C. Mass of abody
B. Volumeof matter D. State of matter.
28. If heat is supplied to a body at its melting point, whathappened?
A. Its bodytemperatureincreases C. Its temperature remainsunchanged
B. Its bodytemperaturedecreases D. It starts to contract.
29. Magnetic field linesare;
A. Imaginarylines C. Sinking into Southpole
B. Springing out ofNorthPole D. All ofthese
4
52
2
IV. Essay typequestions.
1. List those properties of magnetic field lines of amagnet.
2. Draw a bar magnet and indicate magnetic lineforces
3. List some devices that use a magneticmaterial.
4. Show the magnetic lines forcefor
I. Barmagnet II.Earth
5. List at least five uses ofmagnet.
6. Give examples for magneticsubstances
7. State the law ofmagnetism?
8. Which pole is the initial point of magnetic fieldlines;
I. Outside the barmagnet
II. Inside the bar magnet
9. Construct a simple circuit and describe the functions of eachcomponent.
10. List at least four points which describe electricalsafety?
11. Write the differencebetween
I. Cell andBattery
II. Open circuit and Closedcircuit
III. Magnetic and Nonmagnetic substances IV. Geographical magnet and Barmagnets
V. Virtual image and Real image
12. Assume that you have three magnets as shownbelow.
X Y Z U
Magnetic pole X attracts magnetic pole Y and magnetic pole Z repels magnetic pole U. What are the
magnetic poles for letters X, Y, Z and U, respectively?
13. When a magnet is suspended by a string always comes to rest in the North-South direction.Why?
14. How do you know which end of a magnet is NorthPole?
15. What is meant bymagnetization?
16. Electrical energy is convertedinto
A. Light by meansof
B. Heat bymeans of C. Sound bymeans of .
17. What are the main sources of electriccurrent?
18. Explain how electricity comes to home from the powerstation?
19. What electrical effects observed in an electricbulb?
THEEND…..
Notedothequestions
53
4
5