Organic Chemistry Assignment

By Gul Rafil Momin, batch-19

Exercise No.1

Q1 Identify the bond type and molecules for

the following:
1. O2: Covalent bond, diatomic oxygen molecule
2. NH3: Covalent bond, ammonia molecule
3. CCl4: Covalent bond, tetrahedral carbon tetrachloride
molecule
4. CHCl3: Covalent bond, tetrahedral chloroform molecule
5. BF3: Covalent bond, trigonal planar boron trifluoride
molecule
6. H2O: Covalent bond, bent water molecule
7. OF2: Covalent bond, bent oxygen difluoride molecule
8. KCl: Ionic bond, crystalline potassium chloride molecule
9. HCl: Covalent bond, hydrogen chloride molecule
10. N2: Covalent bond, diatomic nitrogen molecule
11. Br2: Covalent bond, diatomic bromine molecule
12. SF6: Covalent bond, octahedral sulfur hexafluoride
molecule
13. SO3: Covalent bond, trigonal planar sulfur trioxide
molecule
14. S2: Covalent bond, diatomic sulfur molecule
15. PbBr2: Ionic bond, crystalline lead(II) bromide molecule
16. CS2: Covalent bond, linear carbon disulfide molecule
17. BaCl2: Ionic bond, crystalline barium chloride molecule

Q2 Answer the following questions.

1) Which compounds are formed by polar bonds?

Answer: NH3, CCl4, CHCl3, H2O, OF2, and HCl are examples
of compounds containing polar bonding.
2) Which compounds are formed by non- polar bonds
and produce non polar molecules?
Answer: N2, Br2, and S2 are a few examples of non-polar
compounds.
3) Give the compounds which are formed by polar bond
but are considered as nonpolar molecules.
Answer: A polar bond-based substance known as CCl4 is
thought to be nonpolar. This is because the main carbon
atom is symmetrically surrounded by four polar C-Cl bonds,
which results in a net dipole moment of zero.
4) Explain why polar bonds do not necessary produce
polar molecules.
Answer: Polar bonds do not always produce polar
molecules, despite the fact that they are symmetrically
arranged around the core atom and have a net dipole value
of zero. Triangular planar, tetrahedral, octahedral, and
other symmetrical molecules may show this. For instance,
BF3 has three polar B-F bonds but is nonpolar due to the
symmetry of the bond configurations around the central
boron atom, which produces a net dipole moment of zero.
 Exercise No. 2
(Alkanes)

Q1. Name the following Alkanes:

A. CH3CH2 CH2 CH2CH2CH2CH3:

➢ heptane
B. CH3CH2CH(CH3)CH2CH2CH3:
➢ 3-methylhexane
C. CH3CH2CH2CH2CH2CH(CH2CH2CH3) CH3:
➢ 2-propylheptane
D. CH3C(CH3)2CH2CH2CH2CH2CH2CH2CH2CH3:
➢ 2,2-dimethyldecane
E. CH3CH2CH(CH3)CH2CH2CH(CH2CH3)CH2CH3:
➢ 3-ethyl-6-methyloctane
Q2. Prepare an octane using the following
preparation:

1) Grignard’s synthesis

C8H17__Cl+Mg Dry Ether

C8H17__MgCl H2O
C8H18+Mg(OH)Cl

2) Wurtz Synthesis

2C4H9__Cl + 2Na Dry Ether

C8H18 + 2NaCl

Q3. Show the Reaction of hexane with

bromine.

Ans: C6H14 + Br2 C6H13Br + HBr

Q4. List 3 examples of alkane found or used in
your house.
Answer:
1) Methane (CH4) is a combustible, colorless, and
odorless gas. Many homes use it primarily as a fuel for
cooking and heating.
2) Butane (C4H10) is a hydrocarbon that is extremely
flammable, colorless, odorless, and readily liquefied. It
is typically used as fuel for portable stoves and
cigarette lighters.
3) Pentane (C5H12) is a straight-chain alkane with 5
carbon atoms. In addition to being a non-polar solvent,
it serves as a refrigerant.